C31H24F3N3O7S2 — CID 19254627
2-[2-ethoxy-4-[(1R,8R,9R)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-hydroxyphenyl)acetamide (PubChem CID 19254627) has the molecular formula C31H24F3N3O7S2 and a molecular weight of 671.67 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(1R,8R,9R)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(1R,8R,9R)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 19254627 |
| Molecular Formula | C31H24F3N3O7S2 |
| Molecular Weight | 671.67 g/mol |
| Exact Mass | 671.10 |
| IUPAC Name | 2-[2-ethoxy-4-[(1R,8R,9R)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-hydroxyphenyl)acetamide |
| SMILES | CCOc1cc([C@@H]2c3sc(=O)[nH]c3S[C@H]3C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)[C@@H]23)ccc1OCC(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C31H24F3N3O7S2/c1-2-43-21-12-15(6-11-20(21)44-14-22(39)35-17-7-9-19(38)10-8-17)23-24-26(45-27-25(23)46-30(42)36-27)29(41)37(28(24)40)18-5-3-4-16(13-18)31(32,33)34/h3-13,23-24,26,38H,2,14H2,1H3,(H,35,39)(H,36,42)/t23-,24-,26+/m0/s1 |
| InChIKey | PYDOJJXQMTWXAM-KYPHJKQUSA-N |
| XLogP | 5.37 |
| TPSA | 138.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.67 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|