C30H24ClN3O7S2 — CID 19254249
2-[4-[(1R,8R,9R)-11-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-2-ethoxyphenoxy]-N-(4-hydroxyphenyl)acetamide (PubChem CID 19254249) has the molecular formula C30H24ClN3O7S2 and a molecular weight of 638.12 g/mol. Its IUPAC name is 2-[4-[(1R,8R,9R)-11-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-2-ethoxyphenoxy]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[4-[(1R,8R,9R)-11-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-2-ethoxyphenoxy]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 19254249 |
| Molecular Formula | C30H24ClN3O7S2 |
| Molecular Weight | 638.12 g/mol |
| Exact Mass | 637.07 |
| IUPAC Name | 2-[4-[(1R,8R,9R)-11-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-2-ethoxyphenoxy]-N-(4-hydroxyphenyl)acetamide |
| SMILES | CCOc1cc([C@@H]2c3sc(=O)[nH]c3S[C@H]3C(=O)N(c4ccc(Cl)cc4)C(=O)[C@@H]23)ccc1OCC(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C30H24ClN3O7S2/c1-2-40-21-13-15(3-12-20(21)41-14-22(36)32-17-6-10-19(35)11-7-17)23-24-26(42-27-25(23)43-30(39)33-27)29(38)34(28(24)37)18-8-4-16(31)5-9-18/h3-13,23-24,26,35H,2,14H2,1H3,(H,32,36)(H,33,39)/t23-,24-,26+/m0/s1 |
| InChIKey | PMLMIRQVXUAOPP-KYPHJKQUSA-N |
| XLogP | 5.01 |
| TPSA | 138.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.12 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|