C31H26ClN3O6S2 — CID 43852076
2-[4-[11-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 43852076) has the molecular formula C31H26ClN3O6S2 and a molecular weight of 636.15 g/mol. Its IUPAC name is 2-[4-[11-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[11-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43852076 |
| Molecular Formula | C31H26ClN3O6S2 |
| Molecular Weight | 636.15 g/mol |
| Exact Mass | 635.10 |
| IUPAC Name | 2-[4-[11-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(C2c3sc(=O)[nH]c3SC3C(=O)N(c4ccc(Cl)cc4)C(=O)C32)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C31H26ClN3O6S2/c1-3-40-22-14-17(6-13-21(22)41-15-23(36)33-19-9-4-16(2)5-10-19)24-25-27(42-28-26(24)43-31(39)34-28)30(38)35(29(25)37)20-11-7-18(32)8-12-20/h4-14,24-25,27H,3,15H2,1-2H3,(H,33,36)(H,34,39) |
| InChIKey | XFQPNGLBDKUDQX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.15 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|