C31H26N4O8S2 — CID 78580096
2-[2-ethoxy-4-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 78580096) has the molecular formula C31H26N4O8S2 and a molecular weight of 646.70 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 78580096 |
| Molecular Formula | C31H26N4O8S2 |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.12 |
| IUPAC Name | 2-[2-ethoxy-4-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc([C@H]2c3sc(=O)[nH]c3SC3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C32)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C31H26N4O8S2/c1-3-42-22-14-17(6-13-21(22)43-15-23(36)32-18-7-4-16(2)5-8-18)24-25-27(44-28-26(24)45-31(39)33-28)30(38)34(29(25)37)19-9-11-20(12-10-19)35(40)41/h4-14,24-25,27H,3,15H2,1-2H3,(H,32,36)(H,33,39)/t24-,25?,27?/m1/s1 |
| InChIKey | SGVLLVOVXRADJL-VTRCLXOYSA-N |
| XLogP | 4.87 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|