C36H32N4O8S2 — CID 78580962
2-[2-ethoxy-4-[(9S)-14-(4-nitrophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 78580962) has the molecular formula C36H32N4O8S2 and a molecular weight of 712.81 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(9S)-14-(4-nitrophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(9S)-14-(4-nitrophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 78580962 |
| Molecular Formula | C36H32N4O8S2 |
| Molecular Weight | 712.81 g/mol |
| Exact Mass | 712.17 |
| IUPAC Name | 2-[2-ethoxy-4-[(9S)-14-(4-nitrophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(c6ccc([N+](=O)[O-])cc6)C(=O)C45)C23)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C36H32N4O8S2/c1-3-47-25-14-18(6-13-24(25)48-16-26(41)37-19-7-4-17(2)5-8-19)27-28-22-15-23(31(28)49-33-32(27)50-36(44)38-33)30-29(22)34(42)39(35(30)43)20-9-11-21(12-10-20)40(45)46/h4-14,22-23,27-31H,3,15-16H2,1-2H3,(H,37,41)(H,38,44) |
| InChIKey | FORARLVSEPTZIO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.81 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|