C36H33N3O7S2 — CID 78581881
2-[2-ethoxy-4-[(9S)-14-(4-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-phenylacetamide (PubChem CID 78581881) has the molecular formula C36H33N3O7S2 and a molecular weight of 683.81 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(9S)-14-(4-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-ethoxy-4-[(9S)-14-(4-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 78581881 |
| Molecular Formula | C36H33N3O7S2 |
| Molecular Weight | 683.81 g/mol |
| Exact Mass | 683.18 |
| IUPAC Name | 2-[2-ethoxy-4-[(9S)-14-(4-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(c6ccc(OC)cc6)C(=O)C45)C23)ccc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C36H33N3O7S2/c1-3-45-25-15-18(9-14-24(25)46-17-26(40)37-19-7-5-4-6-8-19)27-28-22-16-23(31(28)47-33-32(27)48-36(43)38-33)30-29(22)34(41)39(35(30)42)20-10-12-21(44-2)13-11-20/h4-15,22-23,27-31H,3,16-17H2,1-2H3,(H,37,40)(H,38,43) |
| InChIKey | QLMPSPTVCXWVCS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 127.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.81 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|