C42H37N3O8S2 — CID 78581338
ethyl 4-[(9S)-9-[3-ethoxy-4-[2-(naphthalen-2-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 78581338) has the molecular formula C42H37N3O8S2 and a molecular weight of 775.90 g/mol. Its IUPAC name is ethyl 4-[(9S)-9-[3-ethoxy-4-[2-(naphthalen-2-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(9S)-9-[3-ethoxy-4-[2-(naphthalen-2-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 78581338 |
| Molecular Formula | C42H37N3O8S2 |
| Molecular Weight | 775.90 g/mol |
| Exact Mass | 775.20 |
| IUPAC Name | ethyl 4-[(9S)-9-[3-ethoxy-4-[2-(naphthalen-2-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C4CC(C3C2=O)C2C(c3ccc(OCC(=O)Nc5ccc6ccccc6c5)c(OCC)c3)c3sc(=O)[nH]c3SC42)cc1 |
| InChI | InChI=1S/C42H37N3O8S2/c1-3-51-30-18-24(12-16-29(30)53-20-31(46)43-25-13-9-21-7-5-6-8-23(21)17-25)32-33-27-19-28(36(33)54-38-37(32)55-42(50)44-38)35-34(27)39(47)45(40(35)48)26-14-10-22(11-15-26)41(49)52-4-2/h5-18,27-28,32-36H,3-4,19-20H2,1-2H3,(H,43,46)(H,44,50) |
| InChIKey | NLOCRLDEFGUORY-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.90 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|