C40H33N3O7S2 — CID 78582139
ethyl 4-[(9S)-9-[4-[2-(naphthalen-2-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 78582139) has the molecular formula C40H33N3O7S2 and a molecular weight of 731.85 g/mol. Its IUPAC name is ethyl 4-[(9S)-9-[4-[2-(naphthalen-2-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(9S)-9-[4-[2-(naphthalen-2-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 78582139 |
| Molecular Formula | C40H33N3O7S2 |
| Molecular Weight | 731.85 g/mol |
| Exact Mass | 731.18 |
| IUPAC Name | ethyl 4-[(9S)-9-[4-[2-(naphthalen-2-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C4CC(C3C2=O)C2C(c3ccc(OCC(=O)Nc5ccc6ccccc6c5)cc3)c3sc(=O)[nH]c3SC42)cc1 |
| InChI | InChI=1S/C40H33N3O7S2/c1-2-49-39(47)22-8-13-25(14-9-22)43-37(45)32-27-18-28(33(32)38(43)46)34-31(27)30(35-36(51-34)42-40(48)52-35)21-10-15-26(16-11-21)50-19-29(44)41-24-12-7-20-5-3-4-6-23(20)17-24/h3-17,27-28,30-34H,2,18-19H2,1H3,(H,41,44)(H,42,48) |
| InChIKey | LKCONUVXIUWLIE-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.85 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|