C37H30F3N3O7S2 — CID 78581789
ethyl 4-[(9S)-6,13,15-trioxo-9-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 78581789) has the molecular formula C37H30F3N3O7S2 and a molecular weight of 749.79 g/mol. Its IUPAC name is ethyl 4-[(9S)-6,13,15-trioxo-9-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(9S)-6,13,15-trioxo-9-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 78581789 |
| Molecular Formula | C37H30F3N3O7S2 |
| Molecular Weight | 749.79 g/mol |
| Exact Mass | 749.15 |
| IUPAC Name | ethyl 4-[(9S)-6,13,15-trioxo-9-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C4CC(C3C2=O)C2C(c3ccc(OCC(=O)Nc5ccccc5C(F)(F)F)cc3)c3sc(=O)[nH]c3SC42)cc1 |
| InChI | InChI=1S/C37H30F3N3O7S2/c1-2-49-35(47)18-7-11-19(12-8-18)43-33(45)28-21-15-22(29(28)34(43)46)30-27(21)26(31-32(51-30)42-36(48)52-31)17-9-13-20(14-10-17)50-16-25(44)41-24-6-4-3-5-23(24)37(38,39)40/h3-14,21-22,26-30H,2,15-16H2,1H3,(H,41,44)(H,42,48) |
| InChIKey | WLYJZFWXGAXOOH-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.79 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|