C37H29BrF3N3O7S2 — CID 78581343
ethyl 4-[(9S)-9-[5-bromo-2-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 78581343) has the molecular formula C37H29BrF3N3O7S2 and a molecular weight of 828.68 g/mol. Its IUPAC name is ethyl 4-[(9S)-9-[5-bromo-2-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(9S)-9-[5-bromo-2-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 78581343 |
| Molecular Formula | C37H29BrF3N3O7S2 |
| Molecular Weight | 828.68 g/mol |
| Exact Mass | 827.06 |
| IUPAC Name | ethyl 4-[(9S)-9-[5-bromo-2-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C4CC(C3C2=O)C2C(c3cc(Br)ccc3OCC(=O)Nc3ccccc3C(F)(F)F)c3sc(=O)[nH]c3SC42)cc1 |
| InChI | InChI=1S/C37H29BrF3N3O7S2/c1-2-50-35(48)16-7-10-18(11-8-16)44-33(46)28-20-14-21(29(28)34(44)47)30-27(20)26(31-32(52-30)43-36(49)53-31)19-13-17(38)9-12-24(19)51-15-25(45)42-23-6-4-3-5-22(23)37(39,40)41/h3-13,20-21,26-30H,2,14-15H2,1H3,(H,42,45)(H,43,49) |
| InChIKey | YNKZBYGNTVWDLR-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.68 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|