C37H32ClN3O7S2 — CID 43850862
ethyl 4-[(1R,9S,11S)-9-[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 43850862) has the molecular formula C37H32ClN3O7S2 and a molecular weight of 730.26 g/mol. Its IUPAC name is ethyl 4-[(1R,9S,11S)-9-[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(1R,9S,11S)-9-[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 43850862 |
| Molecular Formula | C37H32ClN3O7S2 |
| Molecular Weight | 730.26 g/mol |
| Exact Mass | 729.14 |
| IUPAC Name | ethyl 4-[(1R,9S,11S)-9-[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C(C2=O)[C@@H]2C[C@H]3C3Sc4[nH]c(=O)sc4[C@H](c4cc(Cl)ccc4OCC(=O)Nc4cccc(C)c4)C32)cc1 |
| InChI | InChI=1S/C37H32ClN3O7S2/c1-3-47-36(45)18-7-10-21(11-8-18)41-34(43)29-23-15-24(30(29)35(41)44)31-28(23)27(32-33(49-31)40-37(46)50-32)22-14-19(38)9-12-25(22)48-16-26(42)39-20-6-4-5-17(2)13-20/h4-14,23-24,27-31H,3,15-16H2,1-2H3,(H,39,42)(H,40,46)/t23-,24-,27-,28?,29?,30?,31?/m1/s1 |
| InChIKey | OQSIHNFJTWJLIK-IVPNMWTPSA-N |
| XLogP | 6.27 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.26 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|