C35H27ClF3N3O5S2 — CID 78580661
2-[4-chloro-2-[(9S)-6,13,15-trioxo-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 78580661) has the molecular formula C35H27ClF3N3O5S2 and a molecular weight of 726.20 g/mol. Its IUPAC name is 2-[4-chloro-2-[(9S)-6,13,15-trioxo-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(9S)-6,13,15-trioxo-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 78580661 |
| Molecular Formula | C35H27ClF3N3O5S2 |
| Molecular Weight | 726.20 g/mol |
| Exact Mass | 725.10 |
| IUPAC Name | 2-[4-chloro-2-[(9S)-6,13,15-trioxo-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc(Cl)cc2C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(c6ccccc6C(F)(F)F)C(=O)C45)C23)c1 |
| InChI | InChI=1S/C35H27ClF3N3O5S2/c1-15-5-4-6-17(11-15)40-24(43)14-47-23-10-9-16(36)12-18(23)25-26-19-13-20(29(26)48-31-30(25)49-34(46)41-31)28-27(19)32(44)42(33(28)45)22-8-3-2-7-21(22)35(37,38)39/h2-12,19-20,25-29H,13-14H2,1H3,(H,40,43)(H,41,46) |
| InChIKey | INPIGFZTOKNPNA-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.20 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|