C34H26ClF3N2O4S2 — CID 43849676
(1R,11S)-9-[5-chloro-2-[(2-methylphenyl)methoxy]phenyl]-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 43849676) has the molecular formula C34H26ClF3N2O4S2 and a molecular weight of 683.17 g/mol. Its IUPAC name is (1R,11S)-9-[5-chloro-2-[(2-methylphenyl)methoxy]phenyl]-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,11S)-9-[5-chloro-2-[(2-methylphenyl)methoxy]phenyl]-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 43849676 |
| Molecular Formula | C34H26ClF3N2O4S2 |
| Molecular Weight | 683.17 g/mol |
| Exact Mass | 682.10 |
| IUPAC Name | (1R,11S)-9-[5-chloro-2-[(2-methylphenyl)methoxy]phenyl]-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | Cc1ccccc1COc1ccc(Cl)cc1C1c2sc(=O)[nH]c2SC2C1[C@H]1C[C@@H]2C2C(=O)N(c3ccccc3C(F)(F)F)C(=O)C21 |
| InChI | InChI=1S/C34H26ClF3N2O4S2/c1-15-6-2-3-7-16(15)14-44-23-11-10-17(35)12-18(23)24-25-19-13-20(28(25)45-30-29(24)46-33(43)39-30)27-26(19)31(41)40(32(27)42)22-9-5-4-8-21(22)34(36,37)38/h2-12,19-20,24-28H,13-14H2,1H3,(H,39,43)/t19-,20-,24?,25?,26?,27?,28?/m1/s1 |
| InChIKey | LOXALJPZIKULLC-RJPLWOHGSA-N |
| XLogP | 7.67 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.17 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|