C29H20BrF3N2O4S2 — CID 19251756
(1R,8R,9R)-8-[5-bromo-2-[(2-methylphenyl)methoxy]phenyl]-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 19251756) has the molecular formula C29H20BrF3N2O4S2 and a molecular weight of 661.52 g/mol. Its IUPAC name is (1R,8R,9R)-8-[5-bromo-2-[(2-methylphenyl)methoxy]phenyl]-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1R,8R,9R)-8-[5-bromo-2-[(2-methylphenyl)methoxy]phenyl]-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 19251756 |
| Molecular Formula | C29H20BrF3N2O4S2 |
| Molecular Weight | 661.52 g/mol |
| Exact Mass | 660.00 |
| IUPAC Name | (1R,8R,9R)-8-[5-bromo-2-[(2-methylphenyl)methoxy]phenyl]-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | Cc1ccccc1COc1ccc(Br)cc1[C@@H]1c2sc(=O)[nH]c2S[C@H]2C(=O)N(c3ccccc3C(F)(F)F)C(=O)[C@@H]12 |
| InChI | InChI=1S/C29H20BrF3N2O4S2/c1-14-6-2-3-7-15(14)13-39-20-11-10-16(30)12-17(20)21-22-24(40-25-23(21)41-28(38)34-25)27(37)35(26(22)36)19-9-5-4-8-18(19)29(31,32)33/h2-12,21-22,24H,13H2,1H3,(H,34,38)/t21-,22-,24+/m0/s1 |
| InChIKey | UIEFTHBSLDGMAK-WPFOTENUSA-N |
| XLogP | 6.90 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.52 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|