C24H19BrN2O6S2 — CID 19251184
2-[(1S,8R,9S)-8-[5-bromo-2-[(2-methylphenyl)methoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid (PubChem CID 19251184) has the molecular formula C24H19BrN2O6S2 and a molecular weight of 575.46 g/mol. Its IUPAC name is 2-[(1S,8R,9S)-8-[5-bromo-2-[(2-methylphenyl)methoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid.
| Compound Name | 2-[(1S,8R,9S)-8-[5-bromo-2-[(2-methylphenyl)methoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
|---|---|
| PubChem CID | 19251184 |
| Molecular Formula | C24H19BrN2O6S2 |
| Molecular Weight | 575.46 g/mol |
| Exact Mass | 573.99 |
| IUPAC Name | 2-[(1S,8R,9S)-8-[5-bromo-2-[(2-methylphenyl)methoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
| SMILES | Cc1ccccc1COc1ccc(Br)cc1[C@@H]1c2sc(=O)[nH]c2S[C@@H]2C(=O)N(CC(=O)O)C(=O)[C@H]12 |
| InChI | InChI=1S/C24H19BrN2O6S2/c1-11-4-2-3-5-12(11)10-33-15-7-6-13(25)8-14(15)17-18-20(34-21-19(17)35-24(32)26-21)23(31)27(22(18)30)9-16(28)29/h2-8,17-18,20H,9-10H2,1H3,(H,26,32)(H,28,29)/t17-,18+,20-/m0/s1 |
| InChIKey | MXQHTPRVMGNZLE-NSHGMRRFSA-N |
| XLogP | 3.76 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|