C17H14N2O6S2 — CID 19251144
2-[(1S,8R,9S)-8-(2-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid (PubChem CID 19251144) has the molecular formula C17H14N2O6S2 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-[(1S,8R,9S)-8-(2-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid.
| Compound Name | 2-[(1S,8R,9S)-8-(2-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
|---|---|
| PubChem CID | 19251144 |
| Molecular Formula | C17H14N2O6S2 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 2-[(1S,8R,9S)-8-(2-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
| SMILES | COc1ccccc1[C@@H]1c2sc(=O)[nH]c2S[C@@H]2C(=O)N(CC(=O)O)C(=O)[C@H]12 |
| InChI | InChI=1S/C17H14N2O6S2/c1-25-8-5-3-2-4-7(8)10-11-13(26-14-12(10)27-17(24)18-14)16(23)19(15(11)22)6-9(20)21/h2-5,10-11,13H,6H2,1H3,(H,18,24)(H,20,21)/t10-,11+,13-/m0/s1 |
| InChIKey | ZYFOUWZCCSMLJC-LOWVWBTDSA-N |
| XLogP | 1.12 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|