C16H12N2O6S2 — CID 45155852
2-[(8S)-8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid (PubChem CID 45155852) has the molecular formula C16H12N2O6S2 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-[(8S)-8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid.
| Compound Name | 2-[(8S)-8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
|---|---|
| PubChem CID | 45155852 |
| Molecular Formula | C16H12N2O6S2 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 2-[(8S)-8-(2-hydroxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C2Sc3[nH]c(=O)sc3[C@H](c3ccccc3O)C2C1=O |
| InChI | InChI=1S/C16H12N2O6S2/c19-7-4-2-1-3-6(7)9-10-12(25-13-11(9)26-16(24)17-13)15(23)18(14(10)22)5-8(20)21/h1-4,9-10,12,19H,5H2,(H,17,24)(H,20,21)/t9-,10?,12?/m1/s1 |
| InChIKey | PQIPHAZSKWPSIX-GRZMOONWSA-N |
| XLogP | 0.82 |
| TPSA | 127.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|