C23H18N2O6S2 — CID 43849752
2-[(8R)-5,10,12-trioxo-8-(4-phenylmethoxyphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid (PubChem CID 43849752) has the molecular formula C23H18N2O6S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is 2-[(8R)-5,10,12-trioxo-8-(4-phenylmethoxyphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid.
| Compound Name | 2-[(8R)-5,10,12-trioxo-8-(4-phenylmethoxyphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
|---|---|
| PubChem CID | 43849752 |
| Molecular Formula | C23H18N2O6S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 2-[(8R)-5,10,12-trioxo-8-(4-phenylmethoxyphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C2Sc3[nH]c(=O)sc3[C@@H](c3ccc(OCc4ccccc4)cc3)C2C1=O |
| InChI | InChI=1S/C23H18N2O6S2/c26-15(27)10-25-21(28)17-16(18-20(24-23(30)33-18)32-19(17)22(25)29)13-6-8-14(9-7-13)31-11-12-4-2-1-3-5-12/h1-9,16-17,19H,10-11H2,(H,24,30)(H,26,27)/t16-,17?,19?/m0/s1 |
| InChIKey | RPJDVZXMUFSVFG-MUYFXNHWSA-N |
| XLogP | 2.69 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|