C24H19ClN2O7S2 — CID 78578799
2-[(8S)-8-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid (PubChem CID 78578799) has the molecular formula C24H19ClN2O7S2 and a molecular weight of 547.01 g/mol. Its IUPAC name is 2-[(8S)-8-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid.
| Compound Name | 2-[(8S)-8-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
|---|---|
| PubChem CID | 78578799 |
| Molecular Formula | C24H19ClN2O7S2 |
| Molecular Weight | 547.01 g/mol |
| Exact Mass | 546.03 |
| IUPAC Name | 2-[(8S)-8-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
| SMILES | COc1cc([C@H]2c3sc(=O)[nH]c3SC3C(=O)N(CC(=O)O)C(=O)C32)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H19ClN2O7S2/c1-33-15-8-12(5-6-14(15)34-10-11-3-2-4-13(25)7-11)17-18-20(35-21-19(17)36-24(32)26-21)23(31)27(22(18)30)9-16(28)29/h2-8,17-18,20H,9-10H2,1H3,(H,26,32)(H,28,29)/t17-,18?,20?/m1/s1 |
| InChIKey | VZAXNSWNNIUHMX-PGYGNJIDSA-N |
| XLogP | 3.35 |
| TPSA | 126.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.01 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|