C31H29ClN2O7S2 — CID 19252027
4-[(9S)-9-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid (PubChem CID 19252027) has the molecular formula C31H29ClN2O7S2 and a molecular weight of 641.17 g/mol. Its IUPAC name is 4-[(9S)-9-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid.
| Compound Name | 4-[(9S)-9-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
|---|---|
| PubChem CID | 19252027 |
| Molecular Formula | C31H29ClN2O7S2 |
| Molecular Weight | 641.17 g/mol |
| Exact Mass | 640.11 |
| IUPAC Name | 4-[(9S)-9-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
| SMILES | COc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(CCCC(=O)O)C(=O)C45)C23)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C31H29ClN2O7S2/c1-40-20-11-15(7-8-19(20)41-13-14-4-2-5-16(32)10-14)22-23-17-12-18(26(23)42-28-27(22)43-31(39)33-28)25-24(17)29(37)34(30(25)38)9-3-6-21(35)36/h2,4-5,7-8,10-11,17-18,22-26H,3,6,9,12-13H2,1H3,(H,33,39)(H,35,36) |
| InChIKey | GEGUGZAPEFQCLW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 126.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.17 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|