C32H30ClN3O8S2 — CID 19252092
6-[(9S)-9-[2-[(3-chlorophenyl)methoxy]-5-nitrophenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid (PubChem CID 19252092) has the molecular formula C32H30ClN3O8S2 and a molecular weight of 684.19 g/mol. Its IUPAC name is 6-[(9S)-9-[2-[(3-chlorophenyl)methoxy]-5-nitrophenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid.
| Compound Name | 6-[(9S)-9-[2-[(3-chlorophenyl)methoxy]-5-nitrophenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
|---|---|
| PubChem CID | 19252092 |
| Molecular Formula | C32H30ClN3O8S2 |
| Molecular Weight | 684.19 g/mol |
| Exact Mass | 683.12 |
| IUPAC Name | 6-[(9S)-9-[2-[(3-chlorophenyl)methoxy]-5-nitrophenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)C2C3CC(C2C1=O)C1C(c2cc([N+](=O)[O-])ccc2OCc2cccc(Cl)c2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C32H30ClN3O8S2/c33-16-6-4-5-15(11-16)14-44-21-9-8-17(36(42)43)12-18(21)23-24-19-13-20(27(24)45-29-28(23)46-32(41)34-29)26-25(19)30(39)35(31(26)40)10-3-1-2-7-22(37)38/h4-6,8-9,11-12,19-20,23-27H,1-3,7,10,13-14H2,(H,34,41)(H,37,38) |
| InChIKey | GTHVWVGNWWTCOM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 159.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.19 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|