C32H23BrClN3O6S2 — CID 43849292
(1R,11S)-14-(4-bromophenyl)-9-[2-[(3-chlorophenyl)methoxy]-5-nitrophenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 43849292) has the molecular formula C32H23BrClN3O6S2 and a molecular weight of 725.04 g/mol. Its IUPAC name is (1R,11S)-14-(4-bromophenyl)-9-[2-[(3-chlorophenyl)methoxy]-5-nitrophenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,11S)-14-(4-bromophenyl)-9-[2-[(3-chlorophenyl)methoxy]-5-nitrophenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 43849292 |
| Molecular Formula | C32H23BrClN3O6S2 |
| Molecular Weight | 725.04 g/mol |
| Exact Mass | 722.99 |
| IUPAC Name | (1R,11S)-14-(4-bromophenyl)-9-[2-[(3-chlorophenyl)methoxy]-5-nitrophenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | O=C1C2C(C(=O)N1c1ccc(Br)cc1)[C@@H]1C[C@H]2C2Sc3[nH]c(=O)sc3C(c3cc([N+](=O)[O-])ccc3OCc3cccc(Cl)c3)C21 |
| InChI | InChI=1S/C32H23BrClN3O6S2/c33-15-4-6-17(7-5-15)36-30(38)25-20-12-21(26(25)31(36)39)27-24(20)23(28-29(44-27)35-32(40)45-28)19-11-18(37(41)42)8-9-22(19)43-13-14-2-1-3-16(34)10-14/h1-11,20-21,23-27H,12-13H2,(H,35,40)/t20-,21-,23?,24?,25?,26?,27?/m1/s1 |
| InChIKey | NUAABPZLVXLTET-BOKKFIIESA-N |
| XLogP | 7.02 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.04 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|