C33H32ClN3O7S2 — CID 19255786
6-[(9S)-9-[2-(2-anilino-2-oxoethoxy)-5-chlorophenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid (PubChem CID 19255786) has the molecular formula C33H32ClN3O7S2 and a molecular weight of 682.22 g/mol. Its IUPAC name is 6-[(9S)-9-[2-(2-anilino-2-oxoethoxy)-5-chlorophenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid.
| Compound Name | 6-[(9S)-9-[2-(2-anilino-2-oxoethoxy)-5-chlorophenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
|---|---|
| PubChem CID | 19255786 |
| Molecular Formula | C33H32ClN3O7S2 |
| Molecular Weight | 682.22 g/mol |
| Exact Mass | 681.14 |
| IUPAC Name | 6-[(9S)-9-[2-(2-anilino-2-oxoethoxy)-5-chlorophenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)C2C3CC(C2C1=O)C1C(c2cc(Cl)ccc2OCC(=O)Nc2ccccc2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C33H32ClN3O7S2/c34-16-10-11-21(44-15-22(38)35-17-7-3-1-4-8-17)18(13-16)24-25-19-14-20(28(25)45-30-29(24)46-33(43)36-30)27-26(19)31(41)37(32(27)42)12-6-2-5-9-23(39)40/h1,3-4,7-8,10-11,13,19-20,24-28H,2,5-6,9,12,14-15H2,(H,35,38)(H,36,43)(H,39,40) |
| InChIKey | OZTCYDFAASZXDG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.22 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|