C30H24BrCl2N3O7S2 — CID 19255569
3-[(9S)-9-[5-bromo-2-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid (PubChem CID 19255569) has the molecular formula C30H24BrCl2N3O7S2 and a molecular weight of 753.48 g/mol. Its IUPAC name is 3-[(9S)-9-[5-bromo-2-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid.
| Compound Name | 3-[(9S)-9-[5-bromo-2-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
|---|---|
| PubChem CID | 19255569 |
| Molecular Formula | C30H24BrCl2N3O7S2 |
| Molecular Weight | 753.48 g/mol |
| Exact Mass | 750.96 |
| IUPAC Name | 3-[(9S)-9-[5-bromo-2-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)C2C3CC(C2C1=O)C1C(c2cc(Br)ccc2OCC(=O)Nc2ccc(Cl)c(Cl)c2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C30H24BrCl2N3O7S2/c31-11-1-4-18(43-10-19(37)34-12-2-3-16(32)17(33)8-12)13(7-11)21-22-14-9-15(25(22)44-27-26(21)45-30(42)35-27)24-23(14)28(40)36(29(24)41)6-5-20(38)39/h1-4,7-8,14-15,21-25H,5-6,9-10H2,(H,34,37)(H,35,42)(H,38,39) |
| InChIKey | RYHXXXPAHHZASV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|