C33H25Cl2N3O5S2 — CID 43851353
N-(3,4-dichlorophenyl)-2-[2-[(1R,9S,11S)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide (PubChem CID 43851353) has the molecular formula C33H25Cl2N3O5S2 and a molecular weight of 678.62 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[2-[(1R,9S,11S)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[2-[(1R,9S,11S)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 43851353 |
| Molecular Formula | C33H25Cl2N3O5S2 |
| Molecular Weight | 678.62 g/mol |
| Exact Mass | 677.06 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[2-[(1R,9S,11S)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide |
| SMILES | O=C(COc1ccccc1[C@H]1c2sc(=O)[nH]c2SC2C1[C@H]1C[C@@H]2C2C(=O)N(c3ccccc3)C(=O)C21)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C33H25Cl2N3O5S2/c34-20-11-10-15(12-21(20)35)36-23(39)14-43-22-9-5-4-8-17(22)24-25-18-13-19(28(25)44-30-29(24)45-33(42)37-30)27-26(18)31(40)38(32(27)41)16-6-2-1-3-7-16/h1-12,18-19,24-28H,13-14H2,(H,36,39)(H,37,42)/t18-,19-,24-,25?,26?,27?,28?/m1/s1 |
| InChIKey | WEYJOQVWKCVMIS-GXANWWCWSA-N |
| XLogP | 6.44 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|