C33H27N3O5S2 — CID 19253376
N-phenyl-2-[2-[(1R,2R,9R,10R,11S,12S,16R)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide (PubChem CID 19253376) has the molecular formula C33H27N3O5S2 and a molecular weight of 609.73 g/mol. Its IUPAC name is N-phenyl-2-[2-[(1R,2R,9R,10R,11S,12S,16R)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide.
| Compound Name | N-phenyl-2-[2-[(1R,2R,9R,10R,11S,12S,16R)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 19253376 |
| Molecular Formula | C33H27N3O5S2 |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.14 |
| IUPAC Name | N-phenyl-2-[2-[(1R,2R,9R,10R,11S,12S,16R)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide |
| SMILES | O=C(COc1ccccc1[C@@H]1c2sc(=O)[nH]c2S[C@@H]2[C@@H]3C[C@@H]([C@@H]4C(=O)N(c5ccccc5)C(=O)[C@@H]34)[C@H]12)Nc1ccccc1 |
| InChI | InChI=1S/C33H27N3O5S2/c37-23(34-17-9-3-1-4-10-17)16-41-22-14-8-7-13-19(22)24-25-20-15-21(28(25)42-30-29(24)43-33(40)35-30)27-26(20)31(38)36(32(27)39)18-11-5-2-6-12-18/h1-14,20-21,24-28H,15-16H2,(H,34,37)(H,35,40)/t20-,21-,24+,25-,26+,27+,28-/m1/s1 |
| InChIKey | KHRTWUZOLHZAMH-VNUQONHWSA-N |
| XLogP | 5.13 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|