C23H22N2O7S2 — CID 99729396
2-[(1R,2S,9S,10R,11S,12S,16R)-9-(3,4-dimethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid (PubChem CID 99729396) has the molecular formula C23H22N2O7S2 and a molecular weight of 502.57 g/mol. Its IUPAC name is 2-[(1R,2S,9S,10R,11S,12S,16R)-9-(3,4-dimethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid.
| Compound Name | 2-[(1R,2S,9S,10R,11S,12S,16R)-9-(3,4-dimethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid |
|---|---|
| PubChem CID | 99729396 |
| Molecular Formula | C23H22N2O7S2 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 2-[(1R,2S,9S,10R,11S,12S,16R)-9-(3,4-dimethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid |
| SMILES | COc1ccc([C@H]2c3sc(=O)[nH]c3S[C@H]3[C@@H]4C[C@@H]([C@@H]5C(=O)N(CC(=O)O)C(=O)[C@@H]45)[C@H]23)cc1OC |
| InChI | InChI=1S/C23H22N2O7S2/c1-31-11-4-3-8(5-12(11)32-2)14-15-9-6-10(18(15)33-20-19(14)34-23(30)24-20)17-16(9)21(28)25(22(17)29)7-13(26)27/h3-5,9-10,14-18H,6-7H2,1-2H3,(H,24,30)(H,26,27)/t9-,10-,14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | ACVICMKIVRMSAI-BHCSVMPBSA-N |
| XLogP | 2.01 |
| TPSA | 126.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|