C27H23N3O9S2 — CID 19253883
2-[(1S,8R,9S)-8-[2-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid (PubChem CID 19253883) has the molecular formula C27H23N3O9S2 and a molecular weight of 597.63 g/mol. Its IUPAC name is 2-[(1S,8R,9S)-8-[2-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid.
| Compound Name | 2-[(1S,8R,9S)-8-[2-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
|---|---|
| PubChem CID | 19253883 |
| Molecular Formula | C27H23N3O9S2 |
| Molecular Weight | 597.63 g/mol |
| Exact Mass | 597.09 |
| IUPAC Name | 2-[(1S,8R,9S)-8-[2-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2ccccc2[C@@H]2c3sc(=O)[nH]c3S[C@@H]3C(=O)N(CC(=O)O)C(=O)[C@H]23)cc1 |
| InChI | InChI=1S/C27H23N3O9S2/c1-2-38-26(36)13-7-9-14(10-8-13)28-17(31)12-39-16-6-4-3-5-15(16)19-20-22(40-23-21(19)41-27(37)29-23)25(35)30(24(20)34)11-18(32)33/h3-10,19-20,22H,2,11-12H2,1H3,(H,28,31)(H,29,37)(H,32,33)/t19-,20+,22-/m0/s1 |
| InChIKey | UTVRSMYHSGWICV-VWPQPMDRSA-N |
| XLogP | 2.31 |
| TPSA | 172.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.63 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|