C31H24ClN3O7S2 — CID 78581461
ethyl 4-[(8S)-8-[2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 78581461) has the molecular formula C31H24ClN3O7S2 and a molecular weight of 650.13 g/mol. Its IUPAC name is ethyl 4-[(8S)-8-[2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(8S)-8-[2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 78581461 |
| Molecular Formula | C31H24ClN3O7S2 |
| Molecular Weight | 650.13 g/mol |
| Exact Mass | 649.07 |
| IUPAC Name | ethyl 4-[(8S)-8-[2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4[nH]c(=O)sc4[C@H](c4ccccc4OCC(=O)Nc4ccc(Cl)cc4)C3C2=O)cc1 |
| InChI | InChI=1S/C31H24ClN3O7S2/c1-2-41-30(39)16-7-13-19(14-8-16)35-28(37)24-23(25-27(34-31(40)44-25)43-26(24)29(35)38)20-5-3-4-6-21(20)42-15-22(36)33-18-11-9-17(32)10-12-18/h3-14,23-24,26H,2,15H2,1H3,(H,33,36)(H,34,40)/t23-,24?,26?/m1/s1 |
| InChIKey | PHXLPSAOCPTGMA-LPXOAACNSA-N |
| XLogP | 5.08 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.13 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|