C32H23ClF3N3O7S2 — CID 43852493
ethyl 4-[[2-[4-chloro-2-[5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetyl]amino]benzoate (PubChem CID 43852493) has the molecular formula C32H23ClF3N3O7S2 and a molecular weight of 718.13 g/mol. Its IUPAC name is ethyl 4-[[2-[4-chloro-2-[5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[4-chloro-2-[5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 43852493 |
| Molecular Formula | C32H23ClF3N3O7S2 |
| Molecular Weight | 718.13 g/mol |
| Exact Mass | 717.06 |
| IUPAC Name | ethyl 4-[[2-[4-chloro-2-[5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2C2c3sc(=O)[nH]c3SC3C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)C32)cc1 |
| InChI | InChI=1S/C32H23ClF3N3O7S2/c1-2-45-30(43)15-6-9-18(10-7-15)37-22(40)14-46-21-11-8-17(33)13-20(21)23-24-26(47-27-25(23)48-31(44)38-27)29(42)39(28(24)41)19-5-3-4-16(12-19)32(34,35)36/h3-13,23-24,26H,2,14H2,1H3,(H,37,40)(H,38,44) |
| InChIKey | VARPJSDTIBOPRQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.13 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|