C29H20ClF3N4O7S3 — CID 78579764
2-[4-chloro-2-[(8S)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 78579764) has the molecular formula C29H20ClF3N4O7S3 and a molecular weight of 725.15 g/mol. Its IUPAC name is 2-[4-chloro-2-[(8S)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(8S)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 78579764 |
| Molecular Formula | C29H20ClF3N4O7S3 |
| Molecular Weight | 725.15 g/mol |
| Exact Mass | 724.01 |
| IUPAC Name | 2-[4-chloro-2-[(8S)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2[C@H]2c3sc(=O)[nH]c3SC3C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)C32)cc1 |
| InChI | InChI=1S/C29H20ClF3N4O7S3/c30-14-4-9-19(44-12-20(38)35-15-5-7-17(8-6-15)47(34,42)43)18(11-14)21-22-24(45-25-23(21)46-28(41)36-25)27(40)37(26(22)39)16-3-1-2-13(10-16)29(31,32)33/h1-11,21-22,24H,12H2,(H,35,38)(H,36,41)(H2,34,42,43)/t21-,22?,24?/m1/s1 |
| InChIKey | IZBLNSXNQWPKMD-ZLHNRXBCSA-N |
| XLogP | 4.57 |
| TPSA | 168.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.15 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|