C29H21F3N4O7S3 — CID 43852422
N-(4-sulfamoylphenyl)-2-[3-[5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide (PubChem CID 43852422) has the molecular formula C29H21F3N4O7S3 and a molecular weight of 690.70 g/mol. Its IUPAC name is N-(4-sulfamoylphenyl)-2-[3-[5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide.
| Compound Name | N-(4-sulfamoylphenyl)-2-[3-[5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 43852422 |
| Molecular Formula | C29H21F3N4O7S3 |
| Molecular Weight | 690.70 g/mol |
| Exact Mass | 690.05 |
| IUPAC Name | N-(4-sulfamoylphenyl)-2-[3-[5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COc2cccc(C3c4sc(=O)[nH]c4SC4C(=O)N(c5cccc(C(F)(F)F)c5)C(=O)C43)c2)cc1 |
| InChI | InChI=1S/C29H21F3N4O7S3/c30-29(31,32)15-4-2-5-17(12-15)36-26(38)22-21(23-25(35-28(40)45-23)44-24(22)27(36)39)14-3-1-6-18(11-14)43-13-20(37)34-16-7-9-19(10-8-16)46(33,41)42/h1-12,21-22,24H,13H2,(H,34,37)(H,35,40)(H2,33,41,42) |
| InChIKey | GBTWAQKVDBOOEU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 168.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.70 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|