C30H22F3N3O5S2 — CID 78580020
N-(3-methylphenyl)-2-[4-[(8S)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide (PubChem CID 78580020) has the molecular formula C30H22F3N3O5S2 and a molecular weight of 625.65 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[4-[(8S)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide.
| Compound Name | N-(3-methylphenyl)-2-[4-[(8S)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 78580020 |
| Molecular Formula | C30H22F3N3O5S2 |
| Molecular Weight | 625.65 g/mol |
| Exact Mass | 625.10 |
| IUPAC Name | N-(3-methylphenyl)-2-[4-[(8S)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc([C@H]3c4sc(=O)[nH]c4SC4C(=O)N(c5cccc(C(F)(F)F)c5)C(=O)C43)cc2)c1 |
| InChI | InChI=1S/C30H22F3N3O5S2/c1-15-4-2-6-18(12-15)34-21(37)14-41-20-10-8-16(9-11-20)22-23-25(42-26-24(22)43-29(40)35-26)28(39)36(27(23)38)19-7-3-5-17(13-19)30(31,32)33/h2-13,22-23,25H,14H2,1H3,(H,34,37)(H,35,40)/t22-,23?,25?/m1/s1 |
| InChIKey | KCEBYAVFPKSBCZ-BJYSPHJKSA-N |
| XLogP | 5.58 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|