C28H21N3O6S2 — CID 78580414
N-(4-hydroxyphenyl)-2-[3-[(8S)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide (PubChem CID 78580414) has the molecular formula C28H21N3O6S2 and a molecular weight of 559.63 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2-[3-[(8S)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide.
| Compound Name | N-(4-hydroxyphenyl)-2-[3-[(8S)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 78580414 |
| Molecular Formula | C28H21N3O6S2 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.09 |
| IUPAC Name | N-(4-hydroxyphenyl)-2-[3-[(8S)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
| SMILES | O=C(COc1cccc([C@H]2c3sc(=O)[nH]c3SC3C(=O)N(c4ccccc4)C(=O)C32)c1)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C28H21N3O6S2/c32-18-11-9-16(10-12-18)29-20(33)14-37-19-8-4-5-15(13-19)21-22-24(38-25-23(21)39-28(36)30-25)27(35)31(26(22)34)17-6-2-1-3-7-17/h1-13,21-22,24,32H,14H2,(H,29,33)(H,30,36)/t21-,22?,24?/m1/s1 |
| InChIKey | DHSNYUJQLMJYCH-ZLHNRXBCSA-N |
| XLogP | 3.96 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|