C28H20ClN3O5S2 — CID 19254904
2-[4-chloro-2-[(1R,8R,9R)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-phenylacetamide (PubChem CID 19254904) has the molecular formula C28H20ClN3O5S2 and a molecular weight of 578.07 g/mol. Its IUPAC name is 2-[4-chloro-2-[(1R,8R,9R)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-chloro-2-[(1R,8R,9R)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 19254904 |
| Molecular Formula | C28H20ClN3O5S2 |
| Molecular Weight | 578.07 g/mol |
| Exact Mass | 577.05 |
| IUPAC Name | 2-[4-chloro-2-[(1R,8R,9R)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1ccc(Cl)cc1[C@@H]1c2sc(=O)[nH]c2S[C@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]12)Nc1ccccc1 |
| InChI | InChI=1S/C28H20ClN3O5S2/c29-15-11-12-19(37-14-20(33)30-16-7-3-1-4-8-16)18(13-15)21-22-24(38-25-23(21)39-28(36)31-25)27(35)32(26(22)34)17-9-5-2-6-10-17/h1-13,21-22,24H,14H2,(H,30,33)(H,31,36)/t21-,22-,24+/m0/s1 |
| InChIKey | QMQLPFZTYVINPF-WPFOTENUSA-N |
| XLogP | 4.90 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.07 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|