C29H21BrClN3O5S2 — CID 78580457
2-[2-[(8S)-11-(4-bromophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-4-chlorophenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 78580457) has the molecular formula C29H21BrClN3O5S2 and a molecular weight of 670.99 g/mol. Its IUPAC name is 2-[2-[(8S)-11-(4-bromophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-4-chlorophenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2-[(8S)-11-(4-bromophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-4-chlorophenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 78580457 |
| Molecular Formula | C29H21BrClN3O5S2 |
| Molecular Weight | 670.99 g/mol |
| Exact Mass | 668.98 |
| IUPAC Name | 2-[2-[(8S)-11-(4-bromophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-4-chlorophenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc(Cl)cc2[C@H]2c3sc(=O)[nH]c3SC3C(=O)N(c4ccc(Br)cc4)C(=O)C32)c1 |
| InChI | InChI=1S/C29H21BrClN3O5S2/c1-14-3-2-4-17(11-14)32-21(35)13-39-20-10-7-16(31)12-19(20)22-23-25(40-26-24(22)41-29(38)33-26)28(37)34(27(23)36)18-8-5-15(30)6-9-18/h2-12,22-23,25H,13H2,1H3,(H,32,35)(H,33,38)/t22-,23?,25?/m1/s1 |
| InChIKey | KQORGMBJDOXUOJ-BJYSPHJKSA-N |
| XLogP | 5.97 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.99 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|