C30H24BrN3O5S2 — CID 43851888
2-[4-bromo-2-[11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 43851888) has the molecular formula C30H24BrN3O5S2 and a molecular weight of 650.58 g/mol. Its IUPAC name is 2-[4-bromo-2-[11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[4-bromo-2-[11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43851888 |
| Molecular Formula | C30H24BrN3O5S2 |
| Molecular Weight | 650.58 g/mol |
| Exact Mass | 649.03 |
| IUPAC Name | 2-[4-bromo-2-[11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1ccc(N2C(=O)C3Sc4[nH]c(=O)sc4C(c4cc(Br)ccc4OCC(=O)Nc4cccc(C)c4)C3C2=O)cc1 |
| InChI | InChI=1S/C30H24BrN3O5S2/c1-15-6-9-19(10-7-15)34-28(36)24-23(25-27(33-30(38)41-25)40-26(24)29(34)37)20-13-17(31)8-11-21(20)39-14-22(35)32-18-5-3-4-16(2)12-18/h3-13,23-24,26H,14H2,1-2H3,(H,32,35)(H,33,38) |
| InChIKey | LVZKWJHMYSPGBV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.58 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|