C28H18ClFN4O7S2 — CID 78579617
2-[4-chloro-2-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 78579617) has the molecular formula C28H18ClFN4O7S2 and a molecular weight of 641.06 g/mol. Its IUPAC name is 2-[4-chloro-2-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 78579617 |
| Molecular Formula | C28H18ClFN4O7S2 |
| Molecular Weight | 641.06 g/mol |
| Exact Mass | 640.03 |
| IUPAC Name | 2-[4-chloro-2-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1[C@H]1c2sc(=O)[nH]c2SC2C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)C21)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C28H18ClFN4O7S2/c29-13-1-10-19(41-12-20(35)31-15-4-2-14(30)3-5-15)18(11-13)21-22-24(42-25-23(21)43-28(38)32-25)27(37)33(26(22)36)16-6-8-17(9-7-16)34(39)40/h1-11,21-22,24H,12H2,(H,31,35)(H,32,38)/t21-,22?,24?/m1/s1 |
| InChIKey | OQBULWGSNAZPSB-ZLHNRXBCSA-N |
| XLogP | 4.95 |
| TPSA | 151.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.06 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|