C29H21ClN4O7S2 — CID 43852375
2-[4-chloro-2-[11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 43852375) has the molecular formula C29H21ClN4O7S2 and a molecular weight of 637.10 g/mol. Its IUPAC name is 2-[4-chloro-2-[11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43852375 |
| Molecular Formula | C29H21ClN4O7S2 |
| Molecular Weight | 637.10 g/mol |
| Exact Mass | 636.05 |
| IUPAC Name | 2-[4-chloro-2-[11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)COc1ccc(Cl)cc1C1c2sc(=O)[nH]c2SC2C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)C21 |
| InChI | InChI=1S/C29H21ClN4O7S2/c1-14-4-2-3-5-19(14)31-21(35)13-41-20-11-6-15(30)12-18(20)22-23-25(42-26-24(22)43-29(38)32-26)28(37)33(27(23)36)16-7-9-17(10-8-16)34(39)40/h2-12,22-23,25H,13H2,1H3,(H,31,35)(H,32,38) |
| InChIKey | MSUNOZRQGARIID-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 151.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.10 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|