C30H24ClN3O6S2 — CID 43852627
2-[4-chloro-2-[11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 43852627) has the molecular formula C30H24ClN3O6S2 and a molecular weight of 622.12 g/mol. Its IUPAC name is 2-[4-chloro-2-[11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43852627 |
| Molecular Formula | C30H24ClN3O6S2 |
| Molecular Weight | 622.12 g/mol |
| Exact Mass | 621.08 |
| IUPAC Name | 2-[4-chloro-2-[11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | COc1ccc(N2C(=O)C3Sc4[nH]c(=O)sc4C(c4cc(Cl)ccc4OCC(=O)Nc4ccccc4C)C3C2=O)cc1 |
| InChI | InChI=1S/C30H24ClN3O6S2/c1-15-5-3-4-6-20(15)32-22(35)14-40-21-12-7-16(31)13-19(21)23-24-26(41-27-25(23)42-30(38)33-27)29(37)34(28(24)36)17-8-10-18(39-2)11-9-17/h3-13,23-24,26H,14H2,1-2H3,(H,32,35)(H,33,38) |
| InChIKey | CUAHQNFOKLFENF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.12 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|