C32H22N4O7S2 — CID 78579533
N-naphthalen-2-yl-2-[2-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide (PubChem CID 78579533) has the molecular formula C32H22N4O7S2 and a molecular weight of 638.68 g/mol. Its IUPAC name is N-naphthalen-2-yl-2-[2-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide.
| Compound Name | N-naphthalen-2-yl-2-[2-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 78579533 |
| Molecular Formula | C32H22N4O7S2 |
| Molecular Weight | 638.68 g/mol |
| Exact Mass | 638.09 |
| IUPAC Name | N-naphthalen-2-yl-2-[2-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
| SMILES | O=C(COc1ccccc1[C@H]1c2sc(=O)[nH]c2SC2C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)C21)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H22N4O7S2/c37-24(33-19-10-9-17-5-1-2-6-18(17)15-19)16-43-23-8-4-3-7-22(23)25-26-28(44-29-27(25)45-32(40)34-29)31(39)35(30(26)38)20-11-13-21(14-12-20)36(41)42/h1-15,25-26,28H,16H2,(H,33,37)(H,34,40)/t25-,26?,28?/m1/s1 |
| InChIKey | CZROPCAYPJNCEB-DIXXZCBKSA-N |
| XLogP | 5.31 |
| TPSA | 151.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|