C33H25N3O5S2 — CID 19254020
2-[2-[(1R,8R,9R)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-naphthalen-2-ylacetamide (PubChem CID 19254020) has the molecular formula C33H25N3O5S2 and a molecular weight of 607.71 g/mol. Its IUPAC name is 2-[2-[(1R,8R,9R)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[2-[(1R,8R,9R)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 19254020 |
| Molecular Formula | C33H25N3O5S2 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.12 |
| IUPAC Name | 2-[2-[(1R,8R,9R)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-naphthalen-2-ylacetamide |
| SMILES | Cc1ccc(N2C(=O)[C@H]3[C@H](c4ccccc4OCC(=O)Nc4ccc5ccccc5c4)c4sc(=O)[nH]c4S[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C33H25N3O5S2/c1-18-10-14-22(15-11-18)36-31(38)27-26(28-30(35-33(40)43-28)42-29(27)32(36)39)23-8-4-5-9-24(23)41-17-25(37)34-21-13-12-19-6-2-3-7-20(19)16-21/h2-16,26-27,29H,17H2,1H3,(H,34,37)(H,35,40)/t26-,27-,29+/m0/s1 |
| InChIKey | HQQZYIWUAJVUOV-HPUNYJORSA-N |
| XLogP | 5.71 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|