C34H26N4O8S2 — CID 78580137
2-[2-ethoxy-4-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-naphthalen-2-ylacetamide (PubChem CID 78580137) has the molecular formula C34H26N4O8S2 and a molecular weight of 682.74 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[2-ethoxy-4-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 78580137 |
| Molecular Formula | C34H26N4O8S2 |
| Molecular Weight | 682.74 g/mol |
| Exact Mass | 682.12 |
| IUPAC Name | 2-[2-ethoxy-4-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-naphthalen-2-ylacetamide |
| SMILES | CCOc1cc([C@H]2c3sc(=O)[nH]c3SC3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C32)ccc1OCC(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H26N4O8S2/c1-2-45-25-16-20(8-14-24(25)46-17-26(39)35-21-9-7-18-5-3-4-6-19(18)15-21)27-28-30(47-31-29(27)48-34(42)36-31)33(41)37(32(28)40)22-10-12-23(13-11-22)38(43)44/h3-16,27-28,30H,2,17H2,1H3,(H,35,39)(H,36,42)/t27-,28?,30?/m1/s1 |
| InChIKey | IFPILKAFISSXML-NGOKIVCOSA-N |
| XLogP | 5.71 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.74 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|