C30H21F3N4O8S2 — CID 19254476
2-[2-methoxy-4-[(1R,8R,9R)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 19254476) has the molecular formula C30H21F3N4O8S2 and a molecular weight of 686.65 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(1R,8R,9R)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-methoxy-4-[(1R,8R,9R)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 19254476 |
| Molecular Formula | C30H21F3N4O8S2 |
| Molecular Weight | 686.65 g/mol |
| Exact Mass | 686.08 |
| IUPAC Name | 2-[2-methoxy-4-[(1R,8R,9R)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1cc([C@@H]2c3sc(=O)[nH]c3S[C@H]3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)[C@@H]23)ccc1OCC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H21F3N4O8S2/c1-44-20-11-14(5-10-19(20)45-13-21(38)34-16-4-2-3-15(12-16)30(31,32)33)22-23-25(46-26-24(22)47-29(41)35-26)28(40)36(27(23)39)17-6-8-18(9-7-17)37(42)43/h2-12,22-23,25H,13H2,1H3,(H,34,38)(H,35,41)/t22-,23-,25+/m0/s1 |
| InChIKey | YWIUKXDJZIPTNZ-SONWIMMPSA-N |
| XLogP | 5.19 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|