C31H27N3O7S2 — CID 19254736
2-[2-methoxy-4-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 19254736) has the molecular formula C31H27N3O7S2 and a molecular weight of 617.71 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2-methoxy-4-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19254736 |
| Molecular Formula | C31H27N3O7S2 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.13 |
| IUPAC Name | 2-[2-methoxy-4-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | COc1ccc(N2C(=O)[C@H]3[C@H](c4ccc(OCC(=O)Nc5cccc(C)c5)c(OC)c4)c4sc(=O)[nH]c4S[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C31H27N3O7S2/c1-16-5-4-6-18(13-16)32-23(35)15-41-21-12-7-17(14-22(21)40-3)24-25-27(42-28-26(24)43-31(38)33-28)30(37)34(29(25)36)19-8-10-20(39-2)11-9-19/h4-14,24-25,27H,15H2,1-3H3,(H,32,35)(H,33,38)/t24-,25-,27+/m0/s1 |
| InChIKey | GMFJPRIUUORRLM-OHSXHVKISA-N |
| XLogP | 4.58 |
| TPSA | 127.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|