C35H26F3N3O6S2 — CID 19255010
2-[2-ethoxy-4-[(1R,8R,9R)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-naphthalen-2-ylacetamide (PubChem CID 19255010) has the molecular formula C35H26F3N3O6S2 and a molecular weight of 705.74 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(1R,8R,9R)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[2-ethoxy-4-[(1R,8R,9R)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 19255010 |
| Molecular Formula | C35H26F3N3O6S2 |
| Molecular Weight | 705.74 g/mol |
| Exact Mass | 705.12 |
| IUPAC Name | 2-[2-ethoxy-4-[(1R,8R,9R)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-naphthalen-2-ylacetamide |
| SMILES | CCOc1cc([C@@H]2c3sc(=O)[nH]c3S[C@H]3C(=O)N(c4ccccc4C(F)(F)F)C(=O)[C@@H]23)ccc1OCC(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C35H26F3N3O6S2/c1-2-46-25-16-20(12-14-24(25)47-17-26(42)39-21-13-11-18-7-3-4-8-19(18)15-21)27-28-30(48-31-29(27)49-34(45)40-31)33(44)41(32(28)43)23-10-6-5-9-22(23)35(36,37)38/h3-16,27-28,30H,2,17H2,1H3,(H,39,42)(H,40,45)/t27-,28-,30+/m0/s1 |
| InChIKey | SMLQMECYOQLDCX-TWLDFKIOSA-N |
| XLogP | 6.82 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.74 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|