C34H24F3N3O6S2 — CID 43852828
2-[2-methoxy-4-[5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-naphthalen-2-ylacetamide (PubChem CID 43852828) has the molecular formula C34H24F3N3O6S2 and a molecular weight of 691.71 g/mol. Its IUPAC name is 2-[2-methoxy-4-[5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[2-methoxy-4-[5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 43852828 |
| Molecular Formula | C34H24F3N3O6S2 |
| Molecular Weight | 691.71 g/mol |
| Exact Mass | 691.11 |
| IUPAC Name | 2-[2-methoxy-4-[5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-naphthalen-2-ylacetamide |
| SMILES | COc1cc(C2c3sc(=O)[nH]c3SC3C(=O)N(c4ccccc4C(F)(F)F)C(=O)C32)ccc1OCC(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H24F3N3O6S2/c1-45-24-15-19(11-13-23(24)46-16-25(41)38-20-12-10-17-6-2-3-7-18(17)14-20)26-27-29(47-30-28(26)48-33(44)39-30)32(43)40(31(27)42)22-9-5-4-8-21(22)34(35,36)37/h2-15,26-27,29H,16H2,1H3,(H,38,41)(H,39,44) |
| InChIKey | IXPMBXLBYSMTMN-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.71 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|