C32H24F3N3O7S2 — CID 43852799
ethyl 4-[[2-[3-[5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetyl]amino]benzoate (PubChem CID 43852799) has the molecular formula C32H24F3N3O7S2 and a molecular weight of 683.69 g/mol. Its IUPAC name is ethyl 4-[[2-[3-[5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[3-[5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 43852799 |
| Molecular Formula | C32H24F3N3O7S2 |
| Molecular Weight | 683.69 g/mol |
| Exact Mass | 683.10 |
| IUPAC Name | ethyl 4-[[2-[3-[5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2cccc(C3c4sc(=O)[nH]c4SC4C(=O)N(c5ccccc5C(F)(F)F)C(=O)C43)c2)cc1 |
| InChI | InChI=1S/C32H24F3N3O7S2/c1-2-44-30(42)16-10-12-18(13-11-16)36-22(39)15-45-19-7-5-6-17(14-19)23-24-26(46-27-25(23)47-31(43)37-27)29(41)38(28(24)40)21-9-4-3-8-20(21)32(33,34)35/h3-14,23-24,26H,2,15H2,1H3,(H,36,39)(H,37,43) |
| InChIKey | HPUPFGFSLZDEHT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.69 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|