C31H24N4O9S2 — CID 19254459
ethyl 4-[[2-[3-[(1R,8R,9R)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetyl]amino]benzoate (PubChem CID 19254459) has the molecular formula C31H24N4O9S2 and a molecular weight of 660.69 g/mol. Its IUPAC name is ethyl 4-[[2-[3-[(1R,8R,9R)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[3-[(1R,8R,9R)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 19254459 |
| Molecular Formula | C31H24N4O9S2 |
| Molecular Weight | 660.69 g/mol |
| Exact Mass | 660.10 |
| IUPAC Name | ethyl 4-[[2-[3-[(1R,8R,9R)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2cccc([C@@H]3c4sc(=O)[nH]c4S[C@H]4C(=O)N(c5ccc([N+](=O)[O-])cc5)C(=O)[C@@H]34)c2)cc1 |
| InChI | InChI=1S/C31H24N4O9S2/c1-2-43-30(39)16-6-8-18(9-7-16)32-22(36)15-44-21-5-3-4-17(14-21)23-24-26(45-27-25(23)46-31(40)33-27)29(38)34(28(24)37)19-10-12-20(13-11-19)35(41)42/h3-14,23-24,26H,2,15H2,1H3,(H,32,36)(H,33,40)/t23-,24-,26+/m0/s1 |
| InChIKey | VLKWXEUEBZAIKR-KYPHJKQUSA-N |
| XLogP | 4.33 |
| TPSA | 178.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.69 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|