C32H27N3O8S2 — CID 78581002
ethyl 4-[(8S)-8-[2-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 78581002) has the molecular formula C32H27N3O8S2 and a molecular weight of 645.72 g/mol. Its IUPAC name is ethyl 4-[(8S)-8-[2-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(8S)-8-[2-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 78581002 |
| Molecular Formula | C32H27N3O8S2 |
| Molecular Weight | 645.72 g/mol |
| Exact Mass | 645.12 |
| IUPAC Name | ethyl 4-[(8S)-8-[2-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4[nH]c(=O)sc4[C@H](c4ccccc4OCC(=O)Nc4ccc(OC)cc4)C3C2=O)cc1 |
| InChI | InChI=1S/C32H27N3O8S2/c1-3-42-31(39)17-8-12-19(13-9-17)35-29(37)25-24(26-28(34-32(40)45-26)44-27(25)30(35)38)21-6-4-5-7-22(21)43-16-23(36)33-18-10-14-20(41-2)15-11-18/h4-15,24-25,27H,3,16H2,1-2H3,(H,33,36)(H,34,40)/t24-,25?,27?/m1/s1 |
| InChIKey | QFTUYROIQGACKY-VTRCLXOYSA-N |
| XLogP | 4.43 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.72 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|